About 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline
3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline (PubChem CID 82156784) has the molecular formula C19H24N2O
and a molecular weight of 296.41 g/mol. Its IUPAC name is 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline.
Molecular Properties
| Compound Name | 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline |
| PubChem CID | 82156784 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline |
| SMILES | CC1(C)CNc2ccccc2N1CCCOc1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-19(2)15-20-17-11-6-7-12-18(17)21(19)13-8-14-22-16-9-4-3-5-10-16/h3-7,9-12,20H,8,13-15H2,1-2H3 |
| InChIKey | ABBSSHMBPQWNHV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline?
The IUPAC name of 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline (CID 82156784) is 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline.
What is the SMILES notation for 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline?
The canonical SMILES for 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline is CC1(C)CNc2ccccc2N1CCCOc1ccccc1.
What is the InChIKey of 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline?
The InChIKey is ABBSSHMBPQWNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O/c1-19(2)15-20-17-11-6-7-12-18(17)21(19)13-8-14-22-16-9-4-3-5-10-16/h3-7,9-12,20H,8,13-15H2,1-2H3.
What are the key properties of 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline?
3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline has a molecular weight of 296.41 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline is sourced from PubChem (CID 82156784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).