C19H24N2O — CID 82156784
3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline (PubChem CID 82156784) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline.
| Compound Name | 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 82156784 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3,3-dimethyl-4-(3-phenoxypropyl)-1,2-dihydroquinoxaline |
| SMILES | CC1(C)CNc2ccccc2N1CCCOc1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-19(2)15-20-17-11-6-7-12-18(17)21(19)13-8-14-22-16-9-4-3-5-10-16/h3-7,9-12,20H,8,13-15H2,1-2H3 |
| InChIKey | ABBSSHMBPQWNHV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|