C15H22N2O — CID 82157281
1-butyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one (PubChem CID 82157281) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-butyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-butyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 82157281 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-butyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one |
| SMILES | CCCCN1C(=O)C(C)Nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C15H22N2O/c1-5-6-7-17-14-9-11(3)10(2)8-13(14)16-12(4)15(17)18/h8-9,12,16H,5-7H2,1-4H3 |
| InChIKey | JAGVTCVISGDWAM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |