C13H13N3O3 — CID 82157921
2-(7-ethyl-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]quinoxalin-5-yl)acetonitrile (PubChem CID 82157921) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-(7-ethyl-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]quinoxalin-5-yl)acetonitrile.
| Compound Name | 2-(7-ethyl-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]quinoxalin-5-yl)acetonitrile |
|---|---|
| PubChem CID | 82157921 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-(7-ethyl-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]quinoxalin-5-yl)acetonitrile |
| SMILES | CCC1Nc2cc3c(cc2N(CC#N)C1=O)OCO3 |
| InChI | InChI=1S/C13H13N3O3/c1-2-8-13(17)16(4-3-14)10-6-12-11(18-7-19-12)5-9(10)15-8/h5-6,8,15H,2,4,7H2,1H3 |
| InChIKey | PMPIIJYKNPFUSY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|