About 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol
3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 82157980) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 82157980 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1ccc2c(c1)C(O)CC2N |
| InChI | InChI=1S/C10H13NO/c1-6-2-3-7-8(4-6)10(12)5-9(7)11/h2-4,9-10,12H,5,11H2,1H3 |
| InChIKey | SGJXDEWFWCNFOC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol (CID 82157980) is 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol is Cc1ccc2c(c1)C(O)CC2N.
What is the InChIKey of 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is SGJXDEWFWCNFOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-6-2-3-7-8(4-6)10(12)5-9(7)11/h2-4,9-10,12H,5,11H2,1H3.
What are the key properties of 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol?
3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 163.22 g/mol, XLogP of 1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 82157980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).