About 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one
4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82158219) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 82158219 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC1CC(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H9ClN2O/c10-5-1-2-6-7(11)4-9(13)12-8(6)3-5/h1-3,7H,4,11H2,(H,12,13) |
| InChIKey | INSNIQMNPYAAMY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one (CID 82158219) is 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one is NC1CC(=O)Nc2cc(Cl)ccc21.
What is the InChIKey of 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is INSNIQMNPYAAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O/c10-5-1-2-6-7(11)4-9(13)12-8(6)3-5/h1-3,7H,4,11H2,(H,12,13).
What are the key properties of 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one?
4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 196.64 g/mol, XLogP of 1.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-7-chloro-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 82158219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).