C12H13NO2 — CID 82158256
N,5-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide (PubChem CID 82158256) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is N,5-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide.
| Compound Name | N,5-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 82158256 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N,5-dimethyl-3-oxo-1,2-dihydroindene-1-carboxamide |
| SMILES | CNC(=O)C1CC(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C12H13NO2/c1-7-3-4-8-9(5-7)11(14)6-10(8)12(15)13-2/h3-5,10H,6H2,1-2H3,(H,13,15) |
| InChIKey | LXCICCFRXBCYMP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |