2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid

C14H18O2 — CID 82158629

IUPAC2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid
SMILESCc1cc(C)c2c(c1)CCC2(C)CC(=O)O
InChIInChI=1S/C14H18O2/c1-9-6-10(2)13-11(7-9)4-5-14(13,3)8-12(15)16/h6-7H,4-5,8H2,1-3H3,(H,15,16)
InChIKeyBCHOAVGLURINBF-UHFFFAOYSA-N
MW218.30 g/mol
LogP2.98
Rot. Bonds2

About 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid

2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid (PubChem CID 82158629) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid.

Molecular Properties

Compound Name2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid
PubChem CID82158629
Molecular FormulaC14H18O2
Molecular Weight218.30 g/mol
Exact Mass218.13
IUPAC Name2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid
SMILESCc1cc(C)c2c(c1)CCC2(C)CC(=O)O
InChIInChI=1S/C14H18O2/c1-9-6-10(2)13-11(7-9)4-5-14(13,3)8-12(15)16/h6-7H,4-5,8H2,1-3H3,(H,15,16)
InChIKeyBCHOAVGLURINBF-UHFFFAOYSA-N
XLogP2.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.30
LogP ≤ 52.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid?
The IUPAC name of 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid (CID 82158629) is 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid.
What is the SMILES notation for 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid?
The canonical SMILES for 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid is Cc1cc(C)c2c(c1)CCC2(C)CC(=O)O.
What is the InChIKey of 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid?
The InChIKey is BCHOAVGLURINBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-9-6-10(2)13-11(7-9)4-5-14(13,3)8-12(15)16/h6-7H,4-5,8H2,1-3H3,(H,15,16).
What are the key properties of 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid?
2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid has a molecular weight of 218.30 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5,7-trimethyl-2,3-dihydroinden-1-yl)acetic acid is sourced from PubChem (CID 82158629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).