About 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde
2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde (PubChem CID 82158867) has the molecular formula C13H8N2O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde |
| PubChem CID | 82158867 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde |
| SMILES | O=Cc1ccc2oc(-c3ccccn3)nc2c1 |
| InChI | InChI=1S/C13H8N2O2/c16-8-9-4-5-12-11(7-9)15-13(17-12)10-3-1-2-6-14-10/h1-8H |
| InChIKey | XIWMYFKHFFBMLO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde?
The IUPAC name of 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde (CID 82158867) is 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde.
What is the SMILES notation for 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde?
The canonical SMILES for 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde is O=Cc1ccc2oc(-c3ccccn3)nc2c1.
What is the InChIKey of 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde?
The InChIKey is XIWMYFKHFFBMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2/c16-8-9-4-5-12-11(7-9)15-13(17-12)10-3-1-2-6-14-10/h1-8H.
What are the key properties of 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde?
2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde has a molecular weight of 224.22 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-1,3-benzoxazole-5-carbaldehyde is sourced from PubChem (CID 82158867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).