C12H12O6 — CID 82159711
6,7,8-trimethoxy-4H-isochromene-1,3-dione (PubChem CID 82159711) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 6,7,8-trimethoxy-4H-isochromene-1,3-dione.
| Compound Name | 6,7,8-trimethoxy-4H-isochromene-1,3-dione |
|---|---|
| PubChem CID | 82159711 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 6,7,8-trimethoxy-4H-isochromene-1,3-dione |
| SMILES | COc1cc2c(c(OC)c1OC)C(=O)OC(=O)C2 |
| InChI | InChI=1S/C12H12O6/c1-15-7-4-6-5-8(13)18-12(14)9(6)11(17-3)10(7)16-2/h4H,5H2,1-3H3 |
| InChIKey | BOBGCLLYCYBXGJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|