About [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine
[4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine (PubChem CID 82159825) has the molecular formula C10H12BrNO2
and a molecular weight of 258.12 g/mol. Its IUPAC name is [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine |
| PubChem CID | 82159825 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine |
| SMILES | NCC1OCC(c2ccccc2Br)O1 |
| InChI | InChI=1S/C10H12BrNO2/c11-8-4-2-1-3-7(8)9-6-13-10(5-12)14-9/h1-4,9-10H,5-6,12H2 |
| InChIKey | FCEOEEACELOJHP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine?
The IUPAC name of [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine (CID 82159825) is [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine.
What is the SMILES notation for [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine?
The canonical SMILES for [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine is NCC1OCC(c2ccccc2Br)O1.
What is the InChIKey of [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine?
The InChIKey is FCEOEEACELOJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2/c11-8-4-2-1-3-7(8)9-6-13-10(5-12)14-9/h1-4,9-10H,5-6,12H2.
What are the key properties of [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine?
[4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine has a molecular weight of 258.12 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-bromophenyl)-1,3-dioxolan-2-yl]methanamine is sourced from PubChem (CID 82159825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).