C9H7BrN2OS — CID 82160182
[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanethiol (PubChem CID 82160182) has the molecular formula C9H7BrN2OS and a molecular weight of 271.14 g/mol. Its IUPAC name is [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanethiol.
| Compound Name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 82160182 |
| Molecular Formula | C9H7BrN2OS |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanethiol |
| SMILES | SCc1nnc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C9H7BrN2OS/c10-7-3-1-6(2-4-7)9-12-11-8(5-14)13-9/h1-4,14H,5H2 |
| InChIKey | MGBNZUMYKMMHJH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|