C11H10Cl2N2S — CID 82161765
5-(3,4-dichlorophenyl)-N,4-dimethyl-1,3-thiazol-2-amine (PubChem CID 82161765) has the molecular formula C11H10Cl2N2S and a molecular weight of 273.19 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N,4-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-(3,4-dichlorophenyl)-N,4-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82161765 |
| Molecular Formula | C11H10Cl2N2S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N,4-dimethyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(C)c(-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C11H10Cl2N2S/c1-6-10(16-11(14-2)15-6)7-3-4-8(12)9(13)5-7/h3-5H,1-2H3,(H,14,15) |
| InChIKey | XVELUETUDFZKFB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |