About 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one
4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one (PubChem CID 82162685) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one |
| PubChem CID | 82162685 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one |
| SMILES | CCC1(CC)Oc2cc(C)ccc2N(C(C)CN)C1=O |
| InChI | InChI=1S/C16H24N2O2/c1-5-16(6-2)15(19)18(12(4)10-17)13-8-7-11(3)9-14(13)20-16/h7-9,12H,5-6,10,17H2,1-4H3 |
| InChIKey | QILAMBAWVAIROL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one?
The IUPAC name of 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one (CID 82162685) is 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one?
The canonical SMILES for 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one is CCC1(CC)Oc2cc(C)ccc2N(C(C)CN)C1=O.
What is the InChIKey of 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one?
The InChIKey is QILAMBAWVAIROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-5-16(6-2)15(19)18(12(4)10-17)13-8-7-11(3)9-14(13)20-16/h7-9,12H,5-6,10,17H2,1-4H3.
What are the key properties of 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one?
4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one has a molecular weight of 276.38 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminopropan-2-yl)-2,2-diethyl-7-methyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 82162685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).