About N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine
N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 82163081) has the molecular formula C15H28N4S
and a molecular weight of 296.48 g/mol. Its IUPAC name is N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine |
| PubChem CID | 82163081 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | CC(CN(C)C1CCN(C)CC1)c1nc(CCN)cs1 |
| InChI | InChI=1S/C15H28N4S/c1-12(15-17-13(4-7-16)11-20-15)10-19(3)14-5-8-18(2)9-6-14/h11-12,14H,4-10,16H2,1-3H3 |
| InChIKey | HFLNJATVRRPNQR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine?
The IUPAC name of N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine (CID 82163081) is N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine.
What is the SMILES notation for N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine?
The canonical SMILES for N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine is CC(CN(C)C1CCN(C)CC1)c1nc(CCN)cs1.
What is the InChIKey of N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine?
The InChIKey is HFLNJATVRRPNQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4S/c1-12(15-17-13(4-7-16)11-20-15)10-19(3)14-5-8-18(2)9-6-14/h11-12,14H,4-10,16H2,1-3H3.
What are the key properties of N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine?
N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine has a molecular weight of 296.48 g/mol, XLogP of 1.77, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2-aminoethyl)-1,3-thiazol-2-yl]propyl]-N,1-dimethylpiperidin-4-amine is sourced from PubChem (CID 82163081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).