3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid

C18H20O4 — CID 82165928

IUPAC3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid
SMILESCc1cc(C)cc(OCCOc2cc(C(=O)O)ccc2C)c1
InChIInChI=1S/C18H20O4/c1-12-8-13(2)10-16(9-12)21-6-7-22-17-11-15(18(19)20)5-4-14(17)3/h4-5,8-11H,6-7H2,1-3H3,(H,19,20)
InChIKeyOQALCYUNATZHDF-UHFFFAOYSA-N
MW300.35 g/mol
LogP3.77
Rot. Bonds6

About 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid

3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid (PubChem CID 82165928) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid.

Molecular Properties

Compound Name3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid
PubChem CID82165928
Molecular FormulaC18H20O4
Molecular Weight300.35 g/mol
Exact Mass300.14
IUPAC Name3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid
SMILESCc1cc(C)cc(OCCOc2cc(C(=O)O)ccc2C)c1
InChIInChI=1S/C18H20O4/c1-12-8-13(2)10-16(9-12)21-6-7-22-17-11-15(18(19)20)5-4-14(17)3/h4-5,8-11H,6-7H2,1-3H3,(H,19,20)
InChIKeyOQALCYUNATZHDF-UHFFFAOYSA-N
XLogP3.77
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.35
LogP ≤ 53.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid?
The IUPAC name of 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid (CID 82165928) is 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid.
What is the SMILES notation for 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid?
The canonical SMILES for 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid is Cc1cc(C)cc(OCCOc2cc(C(=O)O)ccc2C)c1.
What is the InChIKey of 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid?
The InChIKey is OQALCYUNATZHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4/c1-12-8-13(2)10-16(9-12)21-6-7-22-17-11-15(18(19)20)5-4-14(17)3/h4-5,8-11H,6-7H2,1-3H3,(H,19,20).
What are the key properties of 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid?
3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid has a molecular weight of 300.35 g/mol, XLogP of 3.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-dimethylphenoxy)ethoxy]-4-methylbenzoic acid is sourced from PubChem (CID 82165928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).