C15H16FN3O2 — CID 82166158
2-[4-(6-fluoroquinolin-2-yl)piperazin-1-yl]acetic acid (PubChem CID 82166158) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[4-(6-fluoroquinolin-2-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(6-fluoroquinolin-2-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 82166158 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[4-(6-fluoroquinolin-2-yl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2ccc3cc(F)ccc3n2)CC1 |
| InChI | InChI=1S/C15H16FN3O2/c16-12-2-3-13-11(9-12)1-4-14(17-13)19-7-5-18(6-8-19)10-15(20)21/h1-4,9H,5-8,10H2,(H,20,21) |
| InChIKey | ZRLLTFYQSHINJX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |