About 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide
4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 82166349) has the molecular formula C11H16N2O3S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide |
| PubChem CID | 82166349 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C)cc2c1OCCC2N |
| InChI | InChI=1S/C11H16N2O3S/c1-7-5-8-9(12)3-4-16-11(8)10(6-7)17(14,15)13-2/h5-6,9,13H,3-4,12H2,1-2H3 |
| InChIKey | MDCQAOCWSLOMPW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide?
The IUPAC name of 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide (CID 82166349) is 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide.
What is the SMILES notation for 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide?
The canonical SMILES for 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide is CNS(=O)(=O)c1cc(C)cc2c1OCCC2N.
What is the InChIKey of 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide?
The InChIKey is MDCQAOCWSLOMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S/c1-7-5-8-9(12)3-4-16-11(8)10(6-7)17(14,15)13-2/h5-6,9,13H,3-4,12H2,1-2H3.
What are the key properties of 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide?
4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide has a molecular weight of 256.33 g/mol, XLogP of 0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,6-dimethyl-3,4-dihydro-2H-chromene-8-sulfonamide is sourced from PubChem (CID 82166349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).