C9H12N4S — CID 82166594
3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 82166594) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | 3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 82166594 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | c1cn2c(C3CCNCC3)nnc2s1 |
| InChI | InChI=1S/C9H12N4S/c1-3-10-4-2-7(1)8-11-12-9-13(8)5-6-14-9/h5-7,10H,1-4H2 |
| InChIKey | BIAISBOMZJSAGU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |