C15H16N4S — CID 82166730
4-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline (PubChem CID 82166730) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 4-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline.
| Compound Name | 4-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline |
|---|---|
| PubChem CID | 82166730 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline |
| SMILES | Cc1ccc(N)cc1-c1nnc2sc3c(n12)CCCC3 |
| InChI | InChI=1S/C15H16N4S/c1-9-6-7-10(16)8-11(9)14-17-18-15-19(14)12-4-2-3-5-13(12)20-15/h6-8H,2-5,16H2,1H3 |
| InChIKey | RMXYYKRTHKYWFY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|