C15H16N4S — CID 82166755
5-phenyl-3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 82166755) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 5-phenyl-3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | 5-phenyl-3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 82166755 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-phenyl-3-piperidin-4-yl-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | c1ccc(-c2csc3nnc(C4CCNCC4)n23)cc1 |
| InChI | InChI=1S/C15H16N4S/c1-2-4-11(5-3-1)13-10-20-15-18-17-14(19(13)15)12-6-8-16-9-7-12/h1-5,10,12,16H,6-9H2 |
| InChIKey | CMZNZIBHGXESLP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |