C16H14N4S — CID 82167340
2-methyl-5-(6-methyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline (PubChem CID 82167340) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-methyl-5-(6-methyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline.
| Compound Name | 2-methyl-5-(6-methyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline |
|---|---|
| PubChem CID | 82167340 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-methyl-5-(6-methyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)aniline |
| SMILES | Cc1ccc2c(c1)sc1nnc(-c3ccc(C)c(N)c3)n12 |
| InChI | InChI=1S/C16H14N4S/c1-9-3-6-13-14(7-9)21-16-19-18-15(20(13)16)11-5-4-10(2)12(17)8-11/h3-8H,17H2,1-2H3 |
| InChIKey | VTCRBZOJJNBRGU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|