About 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile
4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile (PubChem CID 82168412) has the molecular formula C15H15ClN4O
and a molecular weight of 302.77 g/mol. Its IUPAC name is 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile |
| PubChem CID | 82168412 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(OCCc2ncc(C#N)c(N)n2)cc(C)c1Cl |
| InChI | InChI=1S/C15H15ClN4O/c1-9-5-12(6-10(2)14(9)16)21-4-3-13-19-8-11(7-17)15(18)20-13/h5-6,8H,3-4H2,1-2H3,(H2,18,19,20) |
| InChIKey | VPUILRVMTDHTFB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile (CID 82168412) is 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile is Cc1cc(OCCc2ncc(C#N)c(N)n2)cc(C)c1Cl.
What is the InChIKey of 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile?
The InChIKey is VPUILRVMTDHTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4O/c1-9-5-12(6-10(2)14(9)16)21-4-3-13-19-8-11(7-17)15(18)20-13/h5-6,8H,3-4H2,1-2H3,(H2,18,19,20).
What are the key properties of 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile?
4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile has a molecular weight of 302.77 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]pyrimidine-5-carbonitrile is sourced from PubChem (CID 82168412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).