C15H16FN3O2 — CID 82170035
6-(butan-2-ylamino)-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid (PubChem CID 82170035) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 6-(butan-2-ylamino)-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid.
| Compound Name | 6-(butan-2-ylamino)-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 82170035 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 6-(butan-2-ylamino)-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid |
| SMILES | CCC(C)Nc1cc(C(=O)O)nc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H16FN3O2/c1-3-9(2)17-13-8-12(15(20)21)18-14(19-13)10-4-6-11(16)7-5-10/h4-9H,3H2,1-2H3,(H,20,21)(H,17,18,19) |
| InChIKey | NCDBTDLQDRKOFX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |