5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid

C17H18N2O3 — CID 82170483

IUPAC5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid
SMILESCCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)O)n1
InChIInChI=1S/C17H18N2O3/c1-4-5-14-18-9-13(15(19-14)17(21)22)16(20)12-7-6-10(2)11(3)8-12/h6-9H,4-5H2,1-3H3,(H,21,22)
InChIKeySGLRGFPVRQAGIC-UHFFFAOYSA-N
MW298.34 g/mol
LogP2.98
Rot. Bonds5

About 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid

5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid (PubChem CID 82170483) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid
PubChem CID82170483
Molecular FormulaC17H18N2O3
Molecular Weight298.34 g/mol
Exact Mass298.13
IUPAC Name5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid
SMILESCCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)O)n1
InChIInChI=1S/C17H18N2O3/c1-4-5-14-18-9-13(15(19-14)17(21)22)16(20)12-7-6-10(2)11(3)8-12/h6-9H,4-5H2,1-3H3,(H,21,22)
InChIKeySGLRGFPVRQAGIC-UHFFFAOYSA-N
XLogP2.98
TPSA80.15 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 52.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid?
The IUPAC name of 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid (CID 82170483) is 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid.
What is the SMILES notation for 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid?
The canonical SMILES for 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid is CCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)O)n1.
What is the InChIKey of 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid?
The InChIKey is SGLRGFPVRQAGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-4-5-14-18-9-13(15(19-14)17(21)22)16(20)12-7-6-10(2)11(3)8-12/h6-9H,4-5H2,1-3H3,(H,21,22).
What are the key properties of 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid?
5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid has a molecular weight of 298.34 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylbenzoyl)-2-propylpyrimidine-4-carboxylic acid is sourced from PubChem (CID 82170483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).