C10H18N4S — CID 82171608
5-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 82171608) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 5-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82171608 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-[(4-ethylpiperazin-1-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCN1CCN(Cc2cnc(N)s2)CC1 |
| InChI | InChI=1S/C10H18N4S/c1-2-13-3-5-14(6-4-13)8-9-7-12-10(11)15-9/h7H,2-6,8H2,1H3,(H2,11,12) |
| InChIKey | HRSPKXHOGMFHET-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |