C11H18N4O — CID 82171955
2-amino-6-methyl-N-(3-methylbutyl)pyrimidine-4-carboxamide (PubChem CID 82171955) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-amino-6-methyl-N-(3-methylbutyl)pyrimidine-4-carboxamide.
| Compound Name | 2-amino-6-methyl-N-(3-methylbutyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 82171955 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-amino-6-methyl-N-(3-methylbutyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC(C)C)nc(N)n1 |
| InChI | InChI=1S/C11H18N4O/c1-7(2)4-5-13-10(16)9-6-8(3)14-11(12)15-9/h6-7H,4-5H2,1-3H3,(H,13,16)(H2,12,14,15) |
| InChIKey | MJRUSJKCGJJQMM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |