About 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one
7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one (PubChem CID 82172449) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one |
| PubChem CID | 82172449 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one |
| SMILES | CCCC(N)c1cc(C)cc2c1NC(=O)C2C |
| InChI | InChI=1S/C14H20N2O/c1-4-5-12(15)11-7-8(2)6-10-9(3)14(17)16-13(10)11/h6-7,9,12H,4-5,15H2,1-3H3,(H,16,17) |
| InChIKey | XGOQCGNKKJZAPR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one?
The IUPAC name of 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one (CID 82172449) is 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one?
The canonical SMILES for 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one is CCCC(N)c1cc(C)cc2c1NC(=O)C2C.
What is the InChIKey of 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one?
The InChIKey is XGOQCGNKKJZAPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-4-5-12(15)11-7-8(2)6-10-9(3)14(17)16-13(10)11/h6-7,9,12H,4-5,15H2,1-3H3,(H,16,17).
What are the key properties of 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one?
7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one has a molecular weight of 232.33 g/mol, XLogP of 2.85, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-aminobutyl)-3,5-dimethyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 82172449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).