C16H23NO2 — CID 82172640
5-ethyl-7-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one (PubChem CID 82172640) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 5-ethyl-7-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one.
| Compound Name | 5-ethyl-7-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82172640 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5-ethyl-7-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one |
| SMILES | CCCCC(O)c1cc(CC)cc2c1NC(=O)C2C |
| InChI | InChI=1S/C16H23NO2/c1-4-6-7-14(18)13-9-11(5-2)8-12-10(3)16(19)17-15(12)13/h8-10,14,18H,4-7H2,1-3H3,(H,17,19) |
| InChIKey | NQYNRXABTCGDAY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |