About 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one
3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one (PubChem CID 82172672) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one |
| PubChem CID | 82172672 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one |
| SMILES | CCCC(O)c1cc(CC)cc2c1NC(=O)C2CC |
| InChI | InChI=1S/C16H23NO2/c1-4-7-14(18)13-9-10(5-2)8-12-11(6-3)16(19)17-15(12)13/h8-9,11,14,18H,4-7H2,1-3H3,(H,17,19) |
| InChIKey | CBXROOGBJUGFGZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one?
The IUPAC name of 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one (CID 82172672) is 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one?
The canonical SMILES for 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one is CCCC(O)c1cc(CC)cc2c1NC(=O)C2CC.
What is the InChIKey of 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one?
The InChIKey is CBXROOGBJUGFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-4-7-14(18)13-9-10(5-2)8-12-11(6-3)16(19)17-15(12)13/h8-9,11,14,18H,4-7H2,1-3H3,(H,17,19).
What are the key properties of 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one?
3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one has a molecular weight of 261.36 g/mol, XLogP of 3.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-7-(1-hydroxybutyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 82172672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).