About 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one
5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one (PubChem CID 82172765) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one |
| PubChem CID | 82172765 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(C(N)C(C)C)cc2c1NC(=O)C2C |
| InChI | InChI=1S/C14H20N2O/c1-7(2)12(15)10-5-8(3)13-11(6-10)9(4)14(17)16-13/h5-7,9,12H,15H2,1-4H3,(H,16,17) |
| InChIKey | LOWLEAMANSHHIT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one?
The IUPAC name of 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one (CID 82172765) is 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one is Cc1cc(C(N)C(C)C)cc2c1NC(=O)C2C.
What is the InChIKey of 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one?
The InChIKey is LOWLEAMANSHHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-7(2)12(15)10-5-8(3)13-11(6-10)9(4)14(17)16-13/h5-7,9,12H,15H2,1-4H3,(H,16,17).
What are the key properties of 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one?
5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one has a molecular weight of 232.33 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-amino-2-methylpropyl)-3,7-dimethyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 82172765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).