About 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one
5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one (PubChem CID 82172974) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one |
| PubChem CID | 82172974 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one |
| SMILES | CCc1cc(C(N)C(C)C)cc2c1NC(=O)C2CC |
| InChI | InChI=1S/C16H24N2O/c1-5-10-7-11(14(17)9(3)4)8-13-12(6-2)16(19)18-15(10)13/h7-9,12,14H,5-6,17H2,1-4H3,(H,18,19) |
| InChIKey | ZMTIEKIYTPITKQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one?
The IUPAC name of 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one (CID 82172974) is 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one is CCc1cc(C(N)C(C)C)cc2c1NC(=O)C2CC.
What is the InChIKey of 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one?
The InChIKey is ZMTIEKIYTPITKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-5-10-7-11(14(17)9(3)4)8-13-12(6-2)16(19)18-15(10)13/h7-9,12,14H,5-6,17H2,1-4H3,(H,18,19).
What are the key properties of 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one?
5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one has a molecular weight of 260.38 g/mol, XLogP of 3.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-amino-2-methylpropyl)-3,7-diethyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 82172974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).