C18H19FN2O — CID 82173640
5-(1-amino-2-phenylethyl)-7-fluoro-3,3-dimethyl-1H-indol-2-one (PubChem CID 82173640) has the molecular formula C18H19FN2O and a molecular weight of 298.36 g/mol. Its IUPAC name is 5-(1-amino-2-phenylethyl)-7-fluoro-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(1-amino-2-phenylethyl)-7-fluoro-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 82173640 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5-(1-amino-2-phenylethyl)-7-fluoro-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2c(F)cc(C(N)Cc3ccccc3)cc21 |
| InChI | InChI=1S/C18H19FN2O/c1-18(2)13-9-12(10-14(19)16(13)21-17(18)22)15(20)8-11-6-4-3-5-7-11/h3-7,9-10,15H,8,20H2,1-2H3,(H,21,22) |
| InChIKey | QOCXKKNKOWSYIO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |