C10H18N4OS — CID 82176715
N-[5-(4-aminobutyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 82176715) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is N-[5-(4-aminobutyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-(4-aminobutyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 82176715 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[5-(4-aminobutyl)-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nnc(CCCCN)s1 |
| InChI | InChI=1S/C10H18N4OS/c1-7(2)9(15)12-10-14-13-8(16-10)5-3-4-6-11/h7H,3-6,11H2,1-2H3,(H,12,14,15) |
| InChIKey | XRAURPBXFAOURN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|