C13H10N6OS — CID 82176848
N-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide (PubChem CID 82176848) has the molecular formula C13H10N6OS and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 82176848 |
| Molecular Formula | C13H10N6OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide |
| SMILES | Nc1ccc(-c2nnc(NC(=O)c3cnccn3)s2)cc1 |
| InChI | InChI=1S/C13H10N6OS/c14-9-3-1-8(2-4-9)12-18-19-13(21-12)17-11(20)10-7-15-5-6-16-10/h1-7H,14H2,(H,17,19,20) |
| InChIKey | YZMCCBZVANFMGZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|