C12H15NO4S2 — CID 82178684
2-[(4-carbamothioylphenyl)methylsulfonyl]-2-methylpropanoic acid (PubChem CID 82178684) has the molecular formula C12H15NO4S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[(4-carbamothioylphenyl)methylsulfonyl]-2-methylpropanoic acid.
| Compound Name | 2-[(4-carbamothioylphenyl)methylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82178684 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-[(4-carbamothioylphenyl)methylsulfonyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)Cc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C12H15NO4S2/c1-12(2,11(14)15)19(16,17)7-8-3-5-9(6-4-8)10(13)18/h3-6H,7H2,1-2H3,(H2,13,18)(H,14,15) |
| InChIKey | QLVVCGYJBNJVRN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|