C19H19N3O — CID 82179569
3-(cyanomethyl)-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 82179569) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(cyanomethyl)-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 3-(cyanomethyl)-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 82179569 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(cyanomethyl)-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | N#CCc1cccc(C(=O)Nc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C19H19N3O/c20-11-10-15-4-3-5-16(14-15)19(23)21-17-6-8-18(9-7-17)22-12-1-2-13-22/h3-9,14H,1-2,10,12-13H2,(H,21,23) |
| InChIKey | BKVICQJIJCGUOZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|