C11H14Cl2N2OS — CID 82179923
2-(2-aminoethylsulfanyl)-N-(3,5-dichlorophenyl)propanamide (PubChem CID 82179923) has the molecular formula C11H14Cl2N2OS and a molecular weight of 293.22 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-(3,5-dichlorophenyl)propanamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-(3,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 82179923 |
| Molecular Formula | C11H14Cl2N2OS |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-(3,5-dichlorophenyl)propanamide |
| SMILES | CC(SCCN)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2OS/c1-7(17-3-2-14)11(16)15-10-5-8(12)4-9(13)6-10/h4-7H,2-3,14H2,1H3,(H,15,16) |
| InChIKey | WKQBWKMLBFRPHS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |