C18H25NO4 — CID 82183436
1-[3-(4-butoxyphenyl)-3-oxopropyl]pyrrolidine-2-carboxylic acid (PubChem CID 82183436) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-[3-(4-butoxyphenyl)-3-oxopropyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-(4-butoxyphenyl)-3-oxopropyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 82183436 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[3-(4-butoxyphenyl)-3-oxopropyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCOc1ccc(C(=O)CCN2CCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-2-3-13-23-15-8-6-14(7-9-15)17(20)10-12-19-11-4-5-16(19)18(21)22/h6-9,16H,2-5,10-13H2,1H3,(H,21,22) |
| InChIKey | NLLPOJOVKACNJP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|