C16H27N3O2 — CID 82183840
N-[(2-amino-4,5-dimethoxyphenyl)methyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 82183840) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[(2-amino-4,5-dimethoxyphenyl)methyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-[(2-amino-4,5-dimethoxyphenyl)methyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 82183840 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-[(2-amino-4,5-dimethoxyphenyl)methyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | COc1cc(N)c(CN(C)C2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C16H27N3O2/c1-18-7-5-13(6-8-18)19(2)11-12-9-15(20-3)16(21-4)10-14(12)17/h9-10,13H,5-8,11,17H2,1-4H3 |
| InChIKey | ZRUJYXMJYUJVKU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|