About 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol
2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol (PubChem CID 82183866) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol |
| PubChem CID | 82183866 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol |
| SMILES | CCN(CCO)CCCc1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C15H26N2O3/c1-4-17(8-9-18)7-5-6-12-10-13(16)15(20-3)11-14(12)19-2/h10-11,18H,4-9,16H2,1-3H3 |
| InChIKey | SCHCPRNUEZJZJD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol?
The IUPAC name of 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol (CID 82183866) is 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol.
What is the SMILES notation for 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol?
The canonical SMILES for 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol is CCN(CCO)CCCc1cc(N)c(OC)cc1OC.
What is the InChIKey of 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol?
The InChIKey is SCHCPRNUEZJZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-4-17(8-9-18)7-5-6-12-10-13(16)15(20-3)11-14(12)19-2/h10-11,18H,4-9,16H2,1-3H3.
What are the key properties of 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol?
2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol has a molecular weight of 282.38 g/mol, XLogP of 1.53, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(5-amino-2,4-dimethoxyphenyl)propyl-ethylamino]ethanol is sourced from PubChem (CID 82183866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).