C21H29NO2 — CID 82184828
1-[3-[(2-methoxyphenoxy)methyl]phenyl]-4,4-dimethylpentan-3-amine (PubChem CID 82184828) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[3-[(2-methoxyphenoxy)methyl]phenyl]-4,4-dimethylpentan-3-amine.
| Compound Name | 1-[3-[(2-methoxyphenoxy)methyl]phenyl]-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 82184828 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-[3-[(2-methoxyphenoxy)methyl]phenyl]-4,4-dimethylpentan-3-amine |
| SMILES | COc1ccccc1OCc1cccc(CCC(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H29NO2/c1-21(2,3)20(22)13-12-16-8-7-9-17(14-16)15-24-19-11-6-5-10-18(19)23-4/h5-11,14,20H,12-13,15,22H2,1-4H3 |
| InChIKey | HFBMUYPSQDARAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |