C20H24O2 — CID 82185645
1-(4-methylphenyl)-3-[3-(2-methylpropoxy)phenyl]propan-1-one (PubChem CID 82185645) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[3-(2-methylpropoxy)phenyl]propan-1-one.
| Compound Name | 1-(4-methylphenyl)-3-[3-(2-methylpropoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 82185645 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-(4-methylphenyl)-3-[3-(2-methylpropoxy)phenyl]propan-1-one |
| SMILES | Cc1ccc(C(=O)CCc2cccc(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C20H24O2/c1-15(2)14-22-19-6-4-5-17(13-19)9-12-20(21)18-10-7-16(3)8-11-18/h4-8,10-11,13,15H,9,12,14H2,1-3H3 |
| InChIKey | JVMKQGUUTJIHQN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |