C20H25NO — CID 82185961
2-[(3-phenylmethoxyphenyl)methyl]cyclohexan-1-amine (PubChem CID 82185961) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[(3-phenylmethoxyphenyl)methyl]cyclohexan-1-amine.
| Compound Name | 2-[(3-phenylmethoxyphenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 82185961 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[(3-phenylmethoxyphenyl)methyl]cyclohexan-1-amine |
| SMILES | NC1CCCCC1Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H25NO/c21-20-12-5-4-10-18(20)13-17-9-6-11-19(14-17)22-15-16-7-2-1-3-8-16/h1-3,6-9,11,14,18,20H,4-5,10,12-13,15,21H2 |
| InChIKey | UPBYCIVEAZPXAE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |