C14H17NO3 — CID 82186520
1-(4-hydroxy-3,4-dihydro-2H-chromen-3-yl)piperidin-4-one (PubChem CID 82186520) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-(4-hydroxy-3,4-dihydro-2H-chromen-3-yl)piperidin-4-one.
| Compound Name | 1-(4-hydroxy-3,4-dihydro-2H-chromen-3-yl)piperidin-4-one |
|---|---|
| PubChem CID | 82186520 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(4-hydroxy-3,4-dihydro-2H-chromen-3-yl)piperidin-4-one |
| SMILES | O=C1CCN(C2COc3ccccc3C2O)CC1 |
| InChI | InChI=1S/C14H17NO3/c16-10-5-7-15(8-6-10)12-9-18-13-4-2-1-3-11(13)14(12)17/h1-4,12,14,17H,5-9H2 |
| InChIKey | IZQZLTKQFIZCLH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |