About 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol
2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol (PubChem CID 82187161) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol |
| PubChem CID | 82187161 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)Oc2ccccc2C(O)C1N1CCOCC1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2)14(16-7-9-18-10-8-16)13(17)11-5-3-4-6-12(11)19-15/h3-6,13-14,17H,7-10H2,1-2H3 |
| InChIKey | AQWYILPJCHIKDK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
The IUPAC name of 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol (CID 82187161) is 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol is CC1(C)Oc2ccccc2C(O)C1N1CCOCC1.
What is the InChIKey of 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
The InChIKey is AQWYILPJCHIKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-15(2)14(16-7-9-18-10-8-16)13(17)11-5-3-4-6-12(11)19-15/h3-6,13-14,17H,7-10H2,1-2H3.
What are the key properties of 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol has a molecular weight of 263.34 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 82187161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).