C19H23NO2 — CID 82188507
4-[benzyl(methyl)amino]-6,8-dimethyl-3,4-dihydro-2H-chromen-3-ol (PubChem CID 82188507) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-[benzyl(methyl)amino]-6,8-dimethyl-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | 4-[benzyl(methyl)amino]-6,8-dimethyl-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 82188507 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-[benzyl(methyl)amino]-6,8-dimethyl-3,4-dihydro-2H-chromen-3-ol |
| SMILES | Cc1cc(C)c2c(c1)C(N(C)Cc1ccccc1)C(O)CO2 |
| InChI | InChI=1S/C19H23NO2/c1-13-9-14(2)19-16(10-13)18(17(21)12-22-19)20(3)11-15-7-5-4-6-8-15/h4-10,17-18,21H,11-12H2,1-3H3 |
| InChIKey | ZMJWZANLTJJBOO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |