C13H20N2O — CID 82189037
3-(aminomethyl)-6-tert-butyl-1-cyclopropylpyridin-2-one (PubChem CID 82189037) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(aminomethyl)-6-tert-butyl-1-cyclopropylpyridin-2-one.
| Compound Name | 3-(aminomethyl)-6-tert-butyl-1-cyclopropylpyridin-2-one |
|---|---|
| PubChem CID | 82189037 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-(aminomethyl)-6-tert-butyl-1-cyclopropylpyridin-2-one |
| SMILES | CC(C)(C)c1ccc(CN)c(=O)n1C1CC1 |
| InChI | InChI=1S/C13H20N2O/c1-13(2,3)11-7-4-9(8-14)12(16)15(11)10-5-6-10/h4,7,10H,5-6,8,14H2,1-3H3 |
| InChIKey | HHJDMUGZDVLGGD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |