C12H16N2O — CID 82190449
5-(3-aminopropyl)-3-methyl-1,3-dihydroindol-2-one (PubChem CID 82190449) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-(3-aminopropyl)-3-methyl-1,3-dihydroindol-2-one.
| Compound Name | 5-(3-aminopropyl)-3-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82190449 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-(3-aminopropyl)-3-methyl-1,3-dihydroindol-2-one |
| SMILES | CC1C(=O)Nc2ccc(CCCN)cc21 |
| InChI | InChI=1S/C12H16N2O/c1-8-10-7-9(3-2-6-13)4-5-11(10)14-12(8)15/h4-5,7-8H,2-3,6,13H2,1H3,(H,14,15) |
| InChIKey | GMALVUINCYUJEY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |