C14H14N4S — CID 82191464
N'-(4-thiophen-2-ylphthalazin-1-yl)ethane-1,2-diamine (PubChem CID 82191464) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is N'-(4-thiophen-2-ylphthalazin-1-yl)ethane-1,2-diamine.
| Compound Name | N'-(4-thiophen-2-ylphthalazin-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82191464 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N'-(4-thiophen-2-ylphthalazin-1-yl)ethane-1,2-diamine |
| SMILES | NCCNc1nnc(-c2cccs2)c2ccccc12 |
| InChI | InChI=1S/C14H14N4S/c15-7-8-16-14-11-5-2-1-4-10(11)13(17-18-14)12-6-3-9-19-12/h1-6,9H,7-8,15H2,(H,16,18) |
| InChIKey | VMGGOPCAIMMSRF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |