C10H13F3N4 — CID 82191941
4-methyl-N-pyrrolidin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 82191941) has the molecular formula C10H13F3N4 and a molecular weight of 246.24 g/mol. Its IUPAC name is 4-methyl-N-pyrrolidin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-N-pyrrolidin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 82191941 |
| Molecular Formula | C10H13F3N4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-methyl-N-pyrrolidin-3-yl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(C(F)(F)F)nc(NC2CCNC2)n1 |
| InChI | InChI=1S/C10H13F3N4/c1-6-4-8(10(11,12)13)17-9(15-6)16-7-2-3-14-5-7/h4,7,14H,2-3,5H2,1H3,(H,15,16,17) |
| InChIKey | BMWKDODKJTUNLW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |